C8H17NS — CID 143942272
ethane;2,4,5-trimethyl-2,3-dihydro-1,3-thiazole (PubChem CID 143942272) has the molecular formula C8H17NS and a molecular weight of 159.30 g/mol. Its IUPAC name is ethane;2,4,5-trimethyl-2,3-dihydro-1,3-thiazole.
| Compound Name | ethane;2,4,5-trimethyl-2,3-dihydro-1,3-thiazole |
|---|---|
| PubChem CID | 143942272 |
| Molecular Formula | C8H17NS |
| Molecular Weight | 159.30 g/mol |
| Exact Mass | 159.11 |
| IUPAC Name | ethane;2,4,5-trimethyl-2,3-dihydro-1,3-thiazole |
| SMILES | CC.CC1=C(C)SC(C)N1 |
| InChI | InChI=1S/C6H11NS.C2H6/c1-4-5(2)8-6(3)7-4;1-2/h6-7H,1-3H3;1-2H3 |
| InChIKey | UJMRCDXHNZOWQH-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.30 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |