About (Z)-2-(aminomethylsulfanyl)-1-N-propylbut-2-ene-1,3-diamine
(Z)-2-(aminomethylsulfanyl)-1-N-propylbut-2-ene-1,3-diamine (PubChem CID 142914657) has the molecular formula C8H19N3S
and a molecular weight of 189.33 g/mol. Its IUPAC name is (Z)-2-(aminomethylsulfanyl)-1-N-propylbut-2-ene-1,3-diamine.
Molecular Properties
| Compound Name | (Z)-2-(aminomethylsulfanyl)-1-N-propylbut-2-ene-1,3-diamine |
| PubChem CID | 142914657 |
| Molecular Formula | C8H19N3S |
| Molecular Weight | 189.33 g/mol |
| Exact Mass | 189.13 |
| IUPAC Name | (Z)-2-(aminomethylsulfanyl)-1-N-propylbut-2-ene-1,3-diamine |
| SMILES | CCCNC/C(SCN)=C(\C)N |
| InChI | InChI=1S/C8H19N3S/c1-3-4-11-5-8(7(2)10)12-6-9/h11H,3-6,9-10H2,1-2H3/b8-7- |
| InChIKey | IOKMRGMLLHTNOT-FPLPWBNLSA-N |
| XLogP | 0.83 |
| TPSA | 64.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.33 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze (Z)-2-(aminomethylsulfanyl)-1-N-propylbut-2-ene-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-2-(aminomethylsulfanyl)-1-N-propylbut-2-ene-1,3-diamine?
The IUPAC name of (Z)-2-(aminomethylsulfanyl)-1-N-propylbut-2-ene-1,3-diamine (CID 142914657) is (Z)-2-(aminomethylsulfanyl)-1-N-propylbut-2-ene-1,3-diamine.
What is the SMILES notation for (Z)-2-(aminomethylsulfanyl)-1-N-propylbut-2-ene-1,3-diamine?
The canonical SMILES for (Z)-2-(aminomethylsulfanyl)-1-N-propylbut-2-ene-1,3-diamine is CCCNC/C(SCN)=C(\C)N.
What is the InChIKey of (Z)-2-(aminomethylsulfanyl)-1-N-propylbut-2-ene-1,3-diamine?
The InChIKey is IOKMRGMLLHTNOT-FPLPWBNLSA-N. The full InChI is InChI=1S/C8H19N3S/c1-3-4-11-5-8(7(2)10)12-6-9/h11H,3-6,9-10H2,1-2H3/b8-7-.
What are the key properties of (Z)-2-(aminomethylsulfanyl)-1-N-propylbut-2-ene-1,3-diamine?
(Z)-2-(aminomethylsulfanyl)-1-N-propylbut-2-ene-1,3-diamine has a molecular weight of 189.33 g/mol, XLogP of 0.83, 6 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-2-(aminomethylsulfanyl)-1-N-propylbut-2-ene-1,3-diamine is sourced from PubChem (CID 142914657), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).