C12H17NS — CID 123443076
4-[(5-methyl-4H-thiopyran-2-yl)methylidene]piperidine (PubChem CID 123443076) has the molecular formula C12H17NS and a molecular weight of 207.34 g/mol. Its IUPAC name is 4-[(5-methyl-4H-thiopyran-2-yl)methylidene]piperidine.
| Compound Name | 4-[(5-methyl-4H-thiopyran-2-yl)methylidene]piperidine |
|---|---|
| PubChem CID | 123443076 |
| Molecular Formula | C12H17NS |
| Molecular Weight | 207.34 g/mol |
| Exact Mass | 207.11 |
| IUPAC Name | 4-[(5-methyl-4H-thiopyran-2-yl)methylidene]piperidine |
| SMILES | CC1=CSC(C=C2CCNCC2)=CC1 |
| InChI | InChI=1S/C12H17NS/c1-10-2-3-12(14-9-10)8-11-4-6-13-7-5-11/h3,8-9,13H,2,4-7H2,1H3 |
| InChIKey | WMFAFEHJYJVMSN-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.34 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |