C12H19NS — CID 142028573
4-[(2E)-2-ethenylpenta-2,4-dienyl]sulfanylpiperidine (PubChem CID 142028573) has the molecular formula C12H19NS and a molecular weight of 209.36 g/mol. Its IUPAC name is 4-[(2E)-2-ethenylpenta-2,4-dienyl]sulfanylpiperidine.
| Compound Name | 4-[(2E)-2-ethenylpenta-2,4-dienyl]sulfanylpiperidine |
|---|---|
| PubChem CID | 142028573 |
| Molecular Formula | C12H19NS |
| Molecular Weight | 209.36 g/mol |
| Exact Mass | 209.12 |
| IUPAC Name | 4-[(2E)-2-ethenylpenta-2,4-dienyl]sulfanylpiperidine |
| SMILES | C=C/C=C(\C=C)CSC1CCNCC1 |
| InChI | InChI=1S/C12H19NS/c1-3-5-11(4-2)10-14-12-6-8-13-9-7-12/h3-5,12-13H,1-2,6-10H2/b11-5+ |
| InChIKey | CGDPONSZMTYFGR-VZUCSPMQSA-N |
| XLogP | 2.77 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.36 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|