C15H27NS — CID 142139244
ethane;4-ethyl-3-[(Z)-prop-1-enyl]-1-thia-8-azaspiro[4.5]dec-3-ene (PubChem CID 142139244) has the molecular formula C15H27NS and a molecular weight of 253.45 g/mol. Its IUPAC name is ethane;4-ethyl-3-[(Z)-prop-1-enyl]-1-thia-8-azaspiro[4.5]dec-3-ene.
| Compound Name | ethane;4-ethyl-3-[(Z)-prop-1-enyl]-1-thia-8-azaspiro[4.5]dec-3-ene |
|---|---|
| PubChem CID | 142139244 |
| Molecular Formula | C15H27NS |
| Molecular Weight | 253.45 g/mol |
| Exact Mass | 253.19 |
| IUPAC Name | ethane;4-ethyl-3-[(Z)-prop-1-enyl]-1-thia-8-azaspiro[4.5]dec-3-ene |
| SMILES | C/C=C\C1=C(CC)C2(CCNCC2)SC1.CC |
| InChI | InChI=1S/C13H21NS.C2H6/c1-3-5-11-10-15-13(12(11)4-2)6-8-14-9-7-13;1-2/h3,5,14H,4,6-10H2,1-2H3;1-2H3/b5-3-; |
| InChIKey | MYHIZJGITDILDG-FBZPGIPVSA-N |
| XLogP | 4.16 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.45 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |