C16H25NS — CID 142015385
4-[(1Z)-buta-1,3-dienyl]-3-ethenyl-2-thia-8-azaspiro[4.5]dec-3-ene;ethane (PubChem CID 142015385) has the molecular formula C16H25NS and a molecular weight of 263.45 g/mol. Its IUPAC name is 4-[(1Z)-buta-1,3-dienyl]-3-ethenyl-2-thia-8-azaspiro[4.5]dec-3-ene;ethane.
| Compound Name | 4-[(1Z)-buta-1,3-dienyl]-3-ethenyl-2-thia-8-azaspiro[4.5]dec-3-ene;ethane |
|---|---|
| PubChem CID | 142015385 |
| Molecular Formula | C16H25NS |
| Molecular Weight | 263.45 g/mol |
| Exact Mass | 263.17 |
| IUPAC Name | 4-[(1Z)-buta-1,3-dienyl]-3-ethenyl-2-thia-8-azaspiro[4.5]dec-3-ene;ethane |
| SMILES | C=C/C=C\C1=C(C=C)SCC12CCNCC2.CC |
| InChI | InChI=1S/C14H19NS.C2H6/c1-3-5-6-12-13(4-2)16-11-14(12)7-9-15-10-8-14;1-2/h3-6,15H,1-2,7-11H2;1-2H3/b6-5-; |
| InChIKey | TVJWYRFAECAIEM-YSMBQZINSA-N |
| XLogP | 4.31 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.45 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|