C17H29NS — CID 142015698
4-[(1Z)-buta-1,3-dienyl]-3-methyl-2-thia-8-azaspiro[4.5]dec-3-ene;ethane;ethene (PubChem CID 142015698) has the molecular formula C17H29NS and a molecular weight of 279.49 g/mol. Its IUPAC name is 4-[(1Z)-buta-1,3-dienyl]-3-methyl-2-thia-8-azaspiro[4.5]dec-3-ene;ethane;ethene.
| Compound Name | 4-[(1Z)-buta-1,3-dienyl]-3-methyl-2-thia-8-azaspiro[4.5]dec-3-ene;ethane;ethene |
|---|---|
| PubChem CID | 142015698 |
| Molecular Formula | C17H29NS |
| Molecular Weight | 279.49 g/mol |
| Exact Mass | 279.20 |
| IUPAC Name | 4-[(1Z)-buta-1,3-dienyl]-3-methyl-2-thia-8-azaspiro[4.5]dec-3-ene;ethane;ethene |
| SMILES | C=C.C=C/C=C\C1=C(C)SCC12CCNCC2.CC |
| InChI | InChI=1S/C13H19NS.C2H6.C2H4/c1-3-4-5-12-11(2)15-10-13(12)6-8-14-9-7-13;2*1-2/h3-5,14H,1,6-10H2,2H3;1-2H3;1-2H2/b5-4-;; |
| InChIKey | UOAVSKIVHKXFFL-WNCVTPEDSA-N |
| XLogP | 4.95 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.49 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|