About 2-(2,2-dimethylbutyl)-3-(2,2-dimethylpentyl)oxirane
2-(2,2-dimethylbutyl)-3-(2,2-dimethylpentyl)oxirane (PubChem CID 123952297) has the molecular formula C15H30O
and a molecular weight of 226.40 g/mol. Its IUPAC name is 2-(2,2-dimethylbutyl)-3-(2,2-dimethylpentyl)oxirane.
Molecular Properties
| Compound Name | 2-(2,2-dimethylbutyl)-3-(2,2-dimethylpentyl)oxirane |
| PubChem CID | 123952297 |
| Molecular Formula | C15H30O |
| Molecular Weight | 226.40 g/mol |
| Exact Mass | 226.23 |
| IUPAC Name | 2-(2,2-dimethylbutyl)-3-(2,2-dimethylpentyl)oxirane |
| SMILES | CCCC(C)(C)CC1OC1CC(C)(C)CC |
| InChI | InChI=1S/C15H30O/c1-7-9-15(5,6)11-13-12(16-13)10-14(3,4)8-2/h12-13H,7-11H2,1-6H3 |
| InChIKey | TWZOQBDRQPEDAT-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.40 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 2-(2,2-dimethylbutyl)-3-(2,2-dimethylpentyl)oxirane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,2-dimethylbutyl)-3-(2,2-dimethylpentyl)oxirane?
The IUPAC name of 2-(2,2-dimethylbutyl)-3-(2,2-dimethylpentyl)oxirane (CID 123952297) is 2-(2,2-dimethylbutyl)-3-(2,2-dimethylpentyl)oxirane.
What is the SMILES notation for 2-(2,2-dimethylbutyl)-3-(2,2-dimethylpentyl)oxirane?
The canonical SMILES for 2-(2,2-dimethylbutyl)-3-(2,2-dimethylpentyl)oxirane is CCCC(C)(C)CC1OC1CC(C)(C)CC.
What is the InChIKey of 2-(2,2-dimethylbutyl)-3-(2,2-dimethylpentyl)oxirane?
The InChIKey is TWZOQBDRQPEDAT-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H30O/c1-7-9-15(5,6)11-13-12(16-13)10-14(3,4)8-2/h12-13H,7-11H2,1-6H3.
What are the key properties of 2-(2,2-dimethylbutyl)-3-(2,2-dimethylpentyl)oxirane?
2-(2,2-dimethylbutyl)-3-(2,2-dimethylpentyl)oxirane has a molecular weight of 226.40 g/mol, XLogP of 4.80, 7 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,2-dimethylbutyl)-3-(2,2-dimethylpentyl)oxirane is sourced from PubChem (CID 123952297), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).