C15H30O — CID 123952297
2-(2,2-dimethylbutyl)-3-(2,2-dimethylpentyl)oxirane (PubChem CID 123952297) has the molecular formula C15H30O and a molecular weight of 226.40 g/mol. Its IUPAC name is 2-(2,2-dimethylbutyl)-3-(2,2-dimethylpentyl)oxirane.
| Compound Name | 2-(2,2-dimethylbutyl)-3-(2,2-dimethylpentyl)oxirane |
|---|---|
| PubChem CID | 123952297 |
| Molecular Formula | C15H30O |
| Molecular Weight | 226.40 g/mol |
| Exact Mass | 226.23 |
| IUPAC Name | 2-(2,2-dimethylbutyl)-3-(2,2-dimethylpentyl)oxirane |
| SMILES | CCCC(C)(C)CC1OC1CC(C)(C)CC |
| InChI | InChI=1S/C15H30O/c1-7-9-15(5,6)11-13-12(16-13)10-14(3,4)8-2/h12-13H,7-11H2,1-6H3 |
| InChIKey | TWZOQBDRQPEDAT-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.40 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|