C13H23N7 — CID 123953042
1-N'-[2-(dimethylamino)ethyl]-3-N'-[5-[(E)-prop-1-enyl]-1H-pyrazol-3-yl]propanediimidamide (PubChem CID 123953042) has the molecular formula C13H23N7 and a molecular weight of 277.38 g/mol. Its IUPAC name is 1-N'-[2-(dimethylamino)ethyl]-3-N'-[5-[(E)-prop-1-enyl]-1H-pyrazol-3-yl]propanediimidamide.
| Compound Name | 1-N'-[2-(dimethylamino)ethyl]-3-N'-[5-[(E)-prop-1-enyl]-1H-pyrazol-3-yl]propanediimidamide |
|---|---|
| PubChem CID | 123953042 |
| Molecular Formula | C13H23N7 |
| Molecular Weight | 277.38 g/mol |
| Exact Mass | 277.20 |
| IUPAC Name | 1-N'-[2-(dimethylamino)ethyl]-3-N'-[5-[(E)-prop-1-enyl]-1H-pyrazol-3-yl]propanediimidamide |
| SMILES | C/C=C/c1cc(/N=C(\N)C/C(N)=N/CCN(C)C)n[nH]1 |
| InChI | InChI=1S/C13H23N7/c1-4-5-10-8-13(19-18-10)17-12(15)9-11(14)16-6-7-20(2)3/h4-5,8H,6-7,9H2,1-3H3,(H2,14,16)(H3,15,17,18,19)/b5-4+ |
| InChIKey | XELMOGWBIRWZJO-SNAWJCMRSA-N |
| XLogP | 0.74 |
| TPSA | 108.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.38 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|