C12H19N4+ — CID 123954047
1,3-dimethyl-4-[1-(methylideneamino)penta-1,3-dien-2-yl]-4H-pyrimidin-3-ium-2-amine (PubChem CID 123954047) has the molecular formula C12H19N4+ and a molecular weight of 219.31 g/mol. Its IUPAC name is 1,3-dimethyl-4-[1-(methylideneamino)penta-1,3-dien-2-yl]-4H-pyrimidin-3-ium-2-amine.
| Compound Name | 1,3-dimethyl-4-[1-(methylideneamino)penta-1,3-dien-2-yl]-4H-pyrimidin-3-ium-2-amine |
|---|---|
| PubChem CID | 123954047 |
| Molecular Formula | C12H19N4+ |
| Molecular Weight | 219.31 g/mol |
| Exact Mass | 219.16 |
| IUPAC Name | 1,3-dimethyl-4-[1-(methylideneamino)penta-1,3-dien-2-yl]-4H-pyrimidin-3-ium-2-amine |
| SMILES | C=NC=C(C=CC)C1C=CN(C)C(N)=[N+]1C |
| InChI | InChI=1S/C12H18N4/c1-5-6-10(9-14-2)11-7-8-15(3)12(13)16(11)4/h5-9,11,13H,2H2,1,3-4H3/p+1 |
| InChIKey | GZNHPPIVZCYVAK-UHFFFAOYSA-O |
| XLogP | 0.93 |
| TPSA | 44.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.31 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|