C11H16N4 — CID 142229286
2-[(E)-cyclohexa-2,4-dien-1-ylidene(dimethylamino)methyl]-1-methylideneguanidine (PubChem CID 142229286) has the molecular formula C11H16N4 and a molecular weight of 204.28 g/mol. Its IUPAC name is 2-[(E)-cyclohexa-2,4-dien-1-ylidene(dimethylamino)methyl]-1-methylideneguanidine.
| Compound Name | 2-[(E)-cyclohexa-2,4-dien-1-ylidene(dimethylamino)methyl]-1-methylideneguanidine |
|---|---|
| PubChem CID | 142229286 |
| Molecular Formula | C11H16N4 |
| Molecular Weight | 204.28 g/mol |
| Exact Mass | 204.14 |
| IUPAC Name | 2-[(E)-cyclohexa-2,4-dien-1-ylidene(dimethylamino)methyl]-1-methylideneguanidine |
| SMILES | C=N/C(N)=N\C(=C1\C=CC=CC1)N(C)C |
| InChI | InChI=1S/C11H16N4/c1-13-11(12)14-10(15(2)3)9-7-5-4-6-8-9/h4-7H,1,8H2,2-3H3,(H2,12,14)/b10-9+ |
| InChIKey | NUOCPDGREJPTJN-MDZDMXLPSA-N |
| XLogP | 1.29 |
| TPSA | 53.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.28 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|