C11H18N2 — CID 143575022
(1E,4Z)-2-ethenyl-1-N',1-N'-dimethyl-3-methylidenehexa-1,4-diene-1,1-diamine (PubChem CID 143575022) has the molecular formula C11H18N2 and a molecular weight of 178.28 g/mol. Its IUPAC name is (1E,4Z)-2-ethenyl-1-N',1-N'-dimethyl-3-methylidenehexa-1,4-diene-1,1-diamine.
| Compound Name | (1E,4Z)-2-ethenyl-1-N',1-N'-dimethyl-3-methylidenehexa-1,4-diene-1,1-diamine |
|---|---|
| PubChem CID | 143575022 |
| Molecular Formula | C11H18N2 |
| Molecular Weight | 178.28 g/mol |
| Exact Mass | 178.15 |
| IUPAC Name | (1E,4Z)-2-ethenyl-1-N',1-N'-dimethyl-3-methylidenehexa-1,4-diene-1,1-diamine |
| SMILES | C=C/C(C(=C)/C=C\C)=C(/N)N(C)C |
| InChI | InChI=1S/C11H18N2/c1-6-8-9(3)10(7-2)11(12)13(4)5/h6-8H,2-3,12H2,1,4-5H3/b8-6-,11-10+ |
| InChIKey | OCUOYPMREHARCN-FEVLKHHISA-N |
| XLogP | 2.04 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.28 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|