C8H12N2 — CID 141023883
1,3-dimethylazepin-2-amine (PubChem CID 141023883) has the molecular formula C8H12N2 and a molecular weight of 136.20 g/mol. Its IUPAC name is 1,3-dimethylazepin-2-amine.
| Compound Name | 1,3-dimethylazepin-2-amine |
|---|---|
| PubChem CID | 141023883 |
| Molecular Formula | C8H12N2 |
| Molecular Weight | 136.20 g/mol |
| Exact Mass | 136.10 |
| IUPAC Name | 1,3-dimethylazepin-2-amine |
| SMILES | CC1=C(N)N(C)C=CC=C1 |
| InChI | InChI=1S/C8H12N2/c1-7-5-3-4-6-10(2)8(7)9/h3-6H,9H2,1-2H3 |
| InChIKey | RARAAVZMXLTPRS-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 136.20 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |