C12H22N2 — CID 143396319
ethane;(1E,3Z)-2-ethenyl-1-(methylideneamino)hepta-1,3-dien-1-amine (PubChem CID 143396319) has the molecular formula C12H22N2 and a molecular weight of 194.32 g/mol. Its IUPAC name is ethane;(1E,3Z)-2-ethenyl-1-(methylideneamino)hepta-1,3-dien-1-amine.
| Compound Name | ethane;(1E,3Z)-2-ethenyl-1-(methylideneamino)hepta-1,3-dien-1-amine |
|---|---|
| PubChem CID | 143396319 |
| Molecular Formula | C12H22N2 |
| Molecular Weight | 194.32 g/mol |
| Exact Mass | 194.18 |
| IUPAC Name | ethane;(1E,3Z)-2-ethenyl-1-(methylideneamino)hepta-1,3-dien-1-amine |
| SMILES | C=CC(/C=C\CCC)=C(/N)N=C.CC |
| InChI | InChI=1S/C10H16N2.C2H6/c1-4-6-7-8-9(5-2)10(11)12-3;1-2/h5,7-8H,2-4,6,11H2,1H3;1-2H3/b8-7-,10-9+; |
| InChIKey | NBSDLLLNROMTKR-AXEASZOCSA-N |
| XLogP | 3.43 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.32 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|