C9H18N2 — CID 141341758
2-methylocta-1,3-diene-1,1-diamine (PubChem CID 141341758) has the molecular formula C9H18N2 and a molecular weight of 154.26 g/mol. Its IUPAC name is 2-methylocta-1,3-diene-1,1-diamine.
| Compound Name | 2-methylocta-1,3-diene-1,1-diamine |
|---|---|
| PubChem CID | 141341758 |
| Molecular Formula | C9H18N2 |
| Molecular Weight | 154.26 g/mol |
| Exact Mass | 154.15 |
| IUPAC Name | 2-methylocta-1,3-diene-1,1-diamine |
| SMILES | CCCCC=CC(C)=C(N)N |
| InChI | InChI=1S/C9H18N2/c1-3-4-5-6-7-8(2)9(10)11/h6-7H,3-5,10-11H2,1-2H3 |
| InChIKey | QOFAXGZGKGUCBM-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.26 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|