C11H20N2O — CID 88775781
(3E)-3,7-dimethylocta-1,3,7-triene;urea (PubChem CID 88775781) has the molecular formula C11H20N2O and a molecular weight of 196.29 g/mol. Its IUPAC name is (3E)-3,7-dimethylocta-1,3,7-triene;urea.
| Compound Name | (3E)-3,7-dimethylocta-1,3,7-triene;urea |
|---|---|
| PubChem CID | 88775781 |
| Molecular Formula | C11H20N2O |
| Molecular Weight | 196.29 g/mol |
| Exact Mass | 196.16 |
| IUPAC Name | (3E)-3,7-dimethylocta-1,3,7-triene;urea |
| SMILES | C=C/C(C)=C/CCC(=C)C.NC(N)=O |
| InChI | InChI=1S/C10H16.CH4N2O/c1-5-10(4)8-6-7-9(2)3;2-1(3)4/h5,8H,1-2,6-7H2,3-4H3;(H4,2,3,4)/b10-8+; |
| InChIKey | QWDGODXUTOMYIN-VRTOBVRTSA-N |
| XLogP | 2.50 |
| TPSA | 69.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.29 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|