C13H17N3 — CID 142258044
2-(1-cyclohepta-1,3,5-trien-1-yl-2-methylprop-1-enyl)-1-methylideneguanidine (PubChem CID 142258044) has the molecular formula C13H17N3 and a molecular weight of 215.30 g/mol. Its IUPAC name is 2-(1-cyclohepta-1,3,5-trien-1-yl-2-methylprop-1-enyl)-1-methylideneguanidine.
| Compound Name | 2-(1-cyclohepta-1,3,5-trien-1-yl-2-methylprop-1-enyl)-1-methylideneguanidine |
|---|---|
| PubChem CID | 142258044 |
| Molecular Formula | C13H17N3 |
| Molecular Weight | 215.30 g/mol |
| Exact Mass | 215.14 |
| IUPAC Name | 2-(1-cyclohepta-1,3,5-trien-1-yl-2-methylprop-1-enyl)-1-methylideneguanidine |
| SMILES | C=N/C(N)=N\C(C1=CC=CC=CC1)=C(C)C |
| InChI | InChI=1S/C13H17N3/c1-10(2)12(16-13(14)15-3)11-8-6-4-5-7-9-11/h4-8H,3,9H2,1-2H3,(H2,14,16) |
| InChIKey | QVBQAEJUMDEFJG-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 50.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.30 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|