C14H24N2 — CID 143256311
ethane;N'-[(3E,5Z)-5-ethenyl-7-methylocta-3,5,7-trien-4-yl]methanimidamide (PubChem CID 143256311) has the molecular formula C14H24N2 and a molecular weight of 220.36 g/mol. Its IUPAC name is ethane;N'-[(3E,5Z)-5-ethenyl-7-methylocta-3,5,7-trien-4-yl]methanimidamide.
| Compound Name | ethane;N'-[(3E,5Z)-5-ethenyl-7-methylocta-3,5,7-trien-4-yl]methanimidamide |
|---|---|
| PubChem CID | 143256311 |
| Molecular Formula | C14H24N2 |
| Molecular Weight | 220.36 g/mol |
| Exact Mass | 220.19 |
| IUPAC Name | ethane;N'-[(3E,5Z)-5-ethenyl-7-methylocta-3,5,7-trien-4-yl]methanimidamide |
| SMILES | C=C/C(=C/C(=C)C)C(=CCC)N=CN.CC |
| InChI | InChI=1S/C12H18N2.C2H6/c1-5-7-12(14-9-13)11(6-2)8-10(3)4;1-2/h6-9H,2-3,5H2,1,4H3,(H2,13,14);1-2H3/b11-8-,12-7+; |
| InChIKey | XSMVLURMCTXEJT-TZMARPLHSA-N |
| XLogP | 3.98 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.36 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|