C9H17N3 — CID 89938679
2-[(Z)-3-ethenylhex-2-en-2-yl]guanidine (PubChem CID 89938679) has the molecular formula C9H17N3 and a molecular weight of 167.25 g/mol. Its IUPAC name is 2-[(Z)-3-ethenylhex-2-en-2-yl]guanidine.
| Compound Name | 2-[(Z)-3-ethenylhex-2-en-2-yl]guanidine |
|---|---|
| PubChem CID | 89938679 |
| Molecular Formula | C9H17N3 |
| Molecular Weight | 167.25 g/mol |
| Exact Mass | 167.14 |
| IUPAC Name | 2-[(Z)-3-ethenylhex-2-en-2-yl]guanidine |
| SMILES | CCC/C(=C(\C)/N=C(N)N)/C=C |
| InChI | InChI=1S/C9H17N3/c1-4-6-8(5-2)7(3)12-9(10)11/h5H,2,4,6H2,1,3H3,(H4,10,11,12)/b8-7+ |
| InChIKey | ULDNEAJNSJIATI-BQYQJAHWSA-N |
| XLogP | 2.00 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | 210 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.25 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|