C15H19N3 — CID 123954140
(2-methyl-9-prop-1-enyl-4,5-dihydro-1H-pyrido[1,2-d][1,4]diazocin-1-yl)methanimine (PubChem CID 123954140) has the molecular formula C15H19N3 and a molecular weight of 241.34 g/mol. Its IUPAC name is (2-methyl-9-prop-1-enyl-4,5-dihydro-1H-pyrido[1,2-d][1,4]diazocin-1-yl)methanimine.
| Compound Name | (2-methyl-9-prop-1-enyl-4,5-dihydro-1H-pyrido[1,2-d][1,4]diazocin-1-yl)methanimine |
|---|---|
| PubChem CID | 123954140 |
| Molecular Formula | C15H19N3 |
| Molecular Weight | 241.34 g/mol |
| Exact Mass | 241.16 |
| IUPAC Name | (2-methyl-9-prop-1-enyl-4,5-dihydro-1H-pyrido[1,2-d][1,4]diazocin-1-yl)methanimine |
| SMILES | [H]/N=C/C1/C(C)=N\CCC=C2C=CC(C=CC)=CN21 |
| InChI | InChI=1S/C15H19N3/c1-3-5-13-7-8-14-6-4-9-17-12(2)15(10-16)18(14)11-13/h3,5-8,10-11,15-16H,4,9H2,1-2H3/b5-3?,14-6?,16-10+,17-12- |
| InChIKey | WXDXGSFHGUIMIA-YQSDKKDQSA-N |
| XLogP | 3.08 |
| TPSA | 39.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.34 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|