C12H16FN3 — CID 134359973
2-[(1E,3Z)-4-fluoro-3-methylhexa-1,3,5-trienyl]-1-methyl-2H-pyrazin-5-amine (PubChem CID 134359973) has the molecular formula C12H16FN3 and a molecular weight of 221.28 g/mol. Its IUPAC name is 2-[(1E,3Z)-4-fluoro-3-methylhexa-1,3,5-trienyl]-1-methyl-2H-pyrazin-5-amine.
| Compound Name | 2-[(1E,3Z)-4-fluoro-3-methylhexa-1,3,5-trienyl]-1-methyl-2H-pyrazin-5-amine |
|---|---|
| PubChem CID | 134359973 |
| Molecular Formula | C12H16FN3 |
| Molecular Weight | 221.28 g/mol |
| Exact Mass | 221.13 |
| IUPAC Name | 2-[(1E,3Z)-4-fluoro-3-methylhexa-1,3,5-trienyl]-1-methyl-2H-pyrazin-5-amine |
| SMILES | C=C/C(F)=C(C)/C=C/C1C=NC(N)=CN1C |
| InChI | InChI=1S/C12H16FN3/c1-4-11(13)9(2)5-6-10-7-15-12(14)8-16(10)3/h4-8,10H,1,14H2,2-3H3/b6-5+,11-9- |
| InChIKey | UCBOAIAADGFEHT-BTHQEHEQSA-N |
| XLogP | 2.11 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.28 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|