C17H16Cl2N2OS — CID 123954599
2-amino-5-chloro-3-(5-chloro-2-propylsulfanylphenyl)indol-3-ol (PubChem CID 123954599) has the molecular formula C17H16Cl2N2OS and a molecular weight of 367.30 g/mol. Its IUPAC name is 2-amino-5-chloro-3-(5-chloro-2-propylsulfanylphenyl)indol-3-ol.
| Compound Name | 2-amino-5-chloro-3-(5-chloro-2-propylsulfanylphenyl)indol-3-ol |
|---|---|
| PubChem CID | 123954599 |
| Molecular Formula | C17H16Cl2N2OS |
| Molecular Weight | 367.30 g/mol |
| Exact Mass | 366.04 |
| IUPAC Name | 2-amino-5-chloro-3-(5-chloro-2-propylsulfanylphenyl)indol-3-ol |
| SMILES | CCCSc1ccc(Cl)cc1C1(O)C(N)=Nc2ccc(Cl)cc21 |
| InChI | InChI=1S/C17H16Cl2N2OS/c1-2-7-23-15-6-4-11(19)9-13(15)17(22)12-8-10(18)3-5-14(12)21-16(17)20/h3-6,8-9,22H,2,7H2,1H3,(H2,20,21) |
| InChIKey | MJMUETIGZMGDET-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 58.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.30 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |