C15H19NO3 — CID 123954655
1-methoxy-7-pent-4-en-2-yloxy-2,4-dihydro-1H-isoquinolin-3-one (PubChem CID 123954655) has the molecular formula C15H19NO3 and a molecular weight of 261.32 g/mol. Its IUPAC name is 1-methoxy-7-pent-4-en-2-yloxy-2,4-dihydro-1H-isoquinolin-3-one.
| Compound Name | 1-methoxy-7-pent-4-en-2-yloxy-2,4-dihydro-1H-isoquinolin-3-one |
|---|---|
| PubChem CID | 123954655 |
| Molecular Formula | C15H19NO3 |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.14 |
| IUPAC Name | 1-methoxy-7-pent-4-en-2-yloxy-2,4-dihydro-1H-isoquinolin-3-one |
| SMILES | C=CCC(C)Oc1ccc2c(c1)C(OC)NC(=O)C2 |
| InChI | InChI=1S/C15H19NO3/c1-4-5-10(2)19-12-7-6-11-8-14(17)16-15(18-3)13(11)9-12/h4,6-7,9-10,15H,1,5,8H2,2-3H3,(H,16,17) |
| InChIKey | KFZCTQUNTRLFRT-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|