About 1-methoxy-7-propoxy-2,4-dihydro-1H-isoquinolin-3-one
1-methoxy-7-propoxy-2,4-dihydro-1H-isoquinolin-3-one (PubChem CID 123455144) has the molecular formula C13H17NO3
and a molecular weight of 235.28 g/mol. Its IUPAC name is 1-methoxy-7-propoxy-2,4-dihydro-1H-isoquinolin-3-one.
Molecular Properties
| Compound Name | 1-methoxy-7-propoxy-2,4-dihydro-1H-isoquinolin-3-one |
| PubChem CID | 123455144 |
| Molecular Formula | C13H17NO3 |
| Molecular Weight | 235.28 g/mol |
| Exact Mass | 235.12 |
| IUPAC Name | 1-methoxy-7-propoxy-2,4-dihydro-1H-isoquinolin-3-one |
| SMILES | CCCOc1ccc2c(c1)C(OC)NC(=O)C2 |
| InChI | InChI=1S/C13H17NO3/c1-3-6-17-10-5-4-9-7-12(15)14-13(16-2)11(9)8-10/h4-5,8,13H,3,6-7H2,1-2H3,(H,14,15) |
| InChIKey | OMWIFROSBKLYOE-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.28 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-methoxy-7-propoxy-2,4-dihydro-1H-isoquinolin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methoxy-7-propoxy-2,4-dihydro-1H-isoquinolin-3-one?
The IUPAC name of 1-methoxy-7-propoxy-2,4-dihydro-1H-isoquinolin-3-one (CID 123455144) is 1-methoxy-7-propoxy-2,4-dihydro-1H-isoquinolin-3-one.
What is the SMILES notation for 1-methoxy-7-propoxy-2,4-dihydro-1H-isoquinolin-3-one?
The canonical SMILES for 1-methoxy-7-propoxy-2,4-dihydro-1H-isoquinolin-3-one is CCCOc1ccc2c(c1)C(OC)NC(=O)C2.
What is the InChIKey of 1-methoxy-7-propoxy-2,4-dihydro-1H-isoquinolin-3-one?
The InChIKey is OMWIFROSBKLYOE-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17NO3/c1-3-6-17-10-5-4-9-7-12(15)14-13(16-2)11(9)8-10/h4-5,8,13H,3,6-7H2,1-2H3,(H,14,15).
What are the key properties of 1-methoxy-7-propoxy-2,4-dihydro-1H-isoquinolin-3-one?
1-methoxy-7-propoxy-2,4-dihydro-1H-isoquinolin-3-one has a molecular weight of 235.28 g/mol, XLogP of 1.79, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methoxy-7-propoxy-2,4-dihydro-1H-isoquinolin-3-one is sourced from PubChem (CID 123455144), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).