About 2-propoxy-9H-thioxanthene 10-oxide
2-propoxy-9H-thioxanthene 10-oxide (PubChem CID 67057427) has the molecular formula C16H16O2S
and a molecular weight of 272.37 g/mol. Its IUPAC name is 2-propoxy-9H-thioxanthene 10-oxide.
Molecular Properties
| Compound Name | 2-propoxy-9H-thioxanthene 10-oxide |
| PubChem CID | 67057427 |
| Molecular Formula | C16H16O2S |
| Molecular Weight | 272.37 g/mol |
| Exact Mass | 272.09 |
| IUPAC Name | 2-propoxy-9H-thioxanthene 10-oxide |
| SMILES | CCCOc1ccc2c(c1)Cc1ccccc1S2=O |
| InChI | InChI=1S/C16H16O2S/c1-2-9-18-14-7-8-16-13(11-14)10-12-5-3-4-6-15(12)19(16)17/h3-8,11H,2,9-10H2,1H3 |
| InChIKey | XTINGKUWACAMEN-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.37 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-propoxy-9H-thioxanthene 10-oxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-propoxy-9H-thioxanthene 10-oxide?
The IUPAC name of 2-propoxy-9H-thioxanthene 10-oxide (CID 67057427) is 2-propoxy-9H-thioxanthene 10-oxide.
What is the SMILES notation for 2-propoxy-9H-thioxanthene 10-oxide?
The canonical SMILES for 2-propoxy-9H-thioxanthene 10-oxide is CCCOc1ccc2c(c1)Cc1ccccc1S2=O.
What is the InChIKey of 2-propoxy-9H-thioxanthene 10-oxide?
The InChIKey is XTINGKUWACAMEN-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16O2S/c1-2-9-18-14-7-8-16-13(11-14)10-12-5-3-4-6-15(12)19(16)17/h3-8,11H,2,9-10H2,1H3.
What are the key properties of 2-propoxy-9H-thioxanthene 10-oxide?
2-propoxy-9H-thioxanthene 10-oxide has a molecular weight of 272.37 g/mol, XLogP of 3.55, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-propoxy-9H-thioxanthene 10-oxide is sourced from PubChem (CID 67057427), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).