About diphenylmethanone;9H-thioxanthene 10-oxide
diphenylmethanone;9H-thioxanthene 10-oxide (PubChem CID 66607485) has the molecular formula C26H20O2S
and a molecular weight of 396.51 g/mol. Its IUPAC name is diphenylmethanone;9H-thioxanthene 10-oxide.
Molecular Properties
| Compound Name | diphenylmethanone;9H-thioxanthene 10-oxide |
| PubChem CID | 66607485 |
| Molecular Formula | C26H20O2S |
| Molecular Weight | 396.51 g/mol |
| Exact Mass | 396.12 |
| IUPAC Name | diphenylmethanone;9H-thioxanthene 10-oxide |
| SMILES | O=C(c1ccccc1)c1ccccc1.O=S1c2ccccc2Cc2ccccc21 |
| InChI | InChI=1S/C13H10OS.C13H10O/c14-15-12-7-3-1-5-10(12)9-11-6-2-4-8-13(11)15;14-13(11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1-8H,9H2;1-10H |
| InChIKey | FNGDRVPWVGJRPT-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 396.51 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze diphenylmethanone;9H-thioxanthene 10-oxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diphenylmethanone;9H-thioxanthene 10-oxide?
The IUPAC name of diphenylmethanone;9H-thioxanthene 10-oxide (CID 66607485) is diphenylmethanone;9H-thioxanthene 10-oxide.
What is the SMILES notation for diphenylmethanone;9H-thioxanthene 10-oxide?
The canonical SMILES for diphenylmethanone;9H-thioxanthene 10-oxide is O=C(c1ccccc1)c1ccccc1.O=S1c2ccccc2Cc2ccccc21.
What is the InChIKey of diphenylmethanone;9H-thioxanthene 10-oxide?
The InChIKey is FNGDRVPWVGJRPT-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10OS.C13H10O/c14-15-12-7-3-1-5-10(12)9-11-6-2-4-8-13(11)15;14-13(11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1-8H,9H2;1-10H.
What are the key properties of diphenylmethanone;9H-thioxanthene 10-oxide?
diphenylmethanone;9H-thioxanthene 10-oxide has a molecular weight of 396.51 g/mol, XLogP of 5.68, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for diphenylmethanone;9H-thioxanthene 10-oxide is sourced from PubChem (CID 66607485), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).