C30H28O3S — CID 67904712
2-hydroxy-1,2-diphenylethanone;2-propan-2-yl-9H-thioxanthene 10-oxide (PubChem CID 67904712) has the molecular formula C30H28O3S and a molecular weight of 468.62 g/mol. Its IUPAC name is 2-hydroxy-1,2-diphenylethanone;2-propan-2-yl-9H-thioxanthene 10-oxide.
| Compound Name | 2-hydroxy-1,2-diphenylethanone;2-propan-2-yl-9H-thioxanthene 10-oxide |
|---|---|
| PubChem CID | 67904712 |
| Molecular Formula | C30H28O3S |
| Molecular Weight | 468.62 g/mol |
| Exact Mass | 468.18 |
| IUPAC Name | 2-hydroxy-1,2-diphenylethanone;2-propan-2-yl-9H-thioxanthene 10-oxide |
| SMILES | CC(C)c1ccc2c(c1)Cc1ccccc1S2=O.O=C(c1ccccc1)C(O)c1ccccc1 |
| InChI | InChI=1S/C16H16OS.C14H12O2/c1-11(2)12-7-8-16-14(9-12)10-13-5-3-4-6-15(13)18(16)17;15-13(11-7-3-1-4-8-11)14(16)12-9-5-2-6-10-12/h3-9,11H,10H2,1-2H3;1-10,13,15H |
| InChIKey | HGYBUKXHFORIQC-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.62 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |