C17H17ClO2S — CID 67095502
1-chloro-3-methyl-4-propoxy-9H-thioxanthene 10-oxide (PubChem CID 67095502) has the molecular formula C17H17ClO2S and a molecular weight of 320.84 g/mol. Its IUPAC name is 1-chloro-3-methyl-4-propoxy-9H-thioxanthene 10-oxide.
| Compound Name | 1-chloro-3-methyl-4-propoxy-9H-thioxanthene 10-oxide |
|---|---|
| PubChem CID | 67095502 |
| Molecular Formula | C17H17ClO2S |
| Molecular Weight | 320.84 g/mol |
| Exact Mass | 320.06 |
| IUPAC Name | 1-chloro-3-methyl-4-propoxy-9H-thioxanthene 10-oxide |
| SMILES | CCCOc1c(C)cc(Cl)c2c1S(=O)c1ccccc1C2 |
| InChI | InChI=1S/C17H17ClO2S/c1-3-8-20-16-11(2)9-14(18)13-10-12-6-4-5-7-15(12)21(19)17(13)16/h4-7,9H,3,8,10H2,1-2H3 |
| InChIKey | RSCHGXLBLGGUMS-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.84 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |