C25H32ClN7OS — CID 123955659
2-[7-(4-chlorophenyl)-4,5,13-trimethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-yl]-1-[(4-methylpiperazin-1-yl)methylamino]ethanol (PubChem CID 123955659) has the molecular formula C25H32ClN7OS and a molecular weight of 514.10 g/mol. Its IUPAC name is 2-[7-(4-chlorophenyl)-4,5,13-trimethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-yl]-1-[(4-methylpiperazin-1-yl)methylamino]ethanol.
| Compound Name | 2-[7-(4-chlorophenyl)-4,5,13-trimethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-yl]-1-[(4-methylpiperazin-1-yl)methylamino]ethanol |
|---|---|
| PubChem CID | 123955659 |
| Molecular Formula | C25H32ClN7OS |
| Molecular Weight | 514.10 g/mol |
| Exact Mass | 513.21 |
| IUPAC Name | 2-[7-(4-chlorophenyl)-4,5,13-trimethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-yl]-1-[(4-methylpiperazin-1-yl)methylamino]ethanol |
| SMILES | Cc1sc2c(c1C)C(c1ccc(Cl)cc1)=NC(CC(O)NCN1CCN(C)CC1)c1nnc(C)n1-2 |
| InChI | InChI=1S/C25H32ClN7OS/c1-15-16(2)35-25-22(15)23(18-5-7-19(26)8-6-18)28-20(24-30-29-17(3)33(24)25)13-21(34)27-14-32-11-9-31(4)10-12-32/h5-8,20-21,27,34H,9-14H2,1-4H3 |
| InChIKey | CGTJPPOEUDKWQS-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 81.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.10 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|