C22H26ClN5O2S — CID 126693181
(2S)-1-[[2-[(9S)-7-(4-chlorophenyl)-4,5,13-trimethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-yl]-1-hydroxyethyl]amino]propan-2-ol (PubChem CID 126693181) has the molecular formula C22H26ClN5O2S and a molecular weight of 460.00 g/mol. Its IUPAC name is (2S)-1-[[2-[(9S)-7-(4-chlorophenyl)-4,5,13-trimethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-yl]-1-hydroxyethyl]amino]propan-2-ol.
| Compound Name | (2S)-1-[[2-[(9S)-7-(4-chlorophenyl)-4,5,13-trimethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-yl]-1-hydroxyethyl]amino]propan-2-ol |
|---|---|
| PubChem CID | 126693181 |
| Molecular Formula | C22H26ClN5O2S |
| Molecular Weight | 460.00 g/mol |
| Exact Mass | 459.15 |
| IUPAC Name | (2S)-1-[[2-[(9S)-7-(4-chlorophenyl)-4,5,13-trimethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-yl]-1-hydroxyethyl]amino]propan-2-ol |
| SMILES | Cc1sc2c(c1C)C(c1ccc(Cl)cc1)=N[C@@H](CC(O)NC[C@H](C)O)c1nnc(C)n1-2 |
| InChI | InChI=1S/C22H26ClN5O2S/c1-11(29)10-24-18(30)9-17-21-27-26-14(4)28(21)22-19(12(2)13(3)31-22)20(25-17)15-5-7-16(23)8-6-15/h5-8,11,17-18,24,29-30H,9-10H2,1-4H3/t11-,17-,18?/m0/s1 |
| InChIKey | SXRMMBWRNOEERI-OTHKLNSRSA-N |
| XLogP | 3.48 |
| TPSA | 95.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.00 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|