C19H20ClN5O3S2 — CID 138691358
[(9R)-7-(4-chlorophenyl)-4,5,13-trimethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-yl]methyl-methylsulfamic acid (PubChem CID 138691358) has the molecular formula C19H20ClN5O3S2 and a molecular weight of 465.99 g/mol. Its IUPAC name is [(9R)-7-(4-chlorophenyl)-4,5,13-trimethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-yl]methyl-methylsulfamic acid.
| Compound Name | [(9R)-7-(4-chlorophenyl)-4,5,13-trimethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-yl]methyl-methylsulfamic acid |
|---|---|
| PubChem CID | 138691358 |
| Molecular Formula | C19H20ClN5O3S2 |
| Molecular Weight | 465.99 g/mol |
| Exact Mass | 465.07 |
| IUPAC Name | [(9R)-7-(4-chlorophenyl)-4,5,13-trimethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-yl]methyl-methylsulfamic acid |
| SMILES | Cc1sc2c(c1C)C(c1ccc(Cl)cc1)=N[C@H](CN(C)S(=O)(=O)O)c1nnc(C)n1-2 |
| InChI | InChI=1S/C19H20ClN5O3S2/c1-10-11(2)29-19-16(10)17(13-5-7-14(20)8-6-13)21-15(9-24(4)30(26,27)28)18-23-22-12(3)25(18)19/h5-8,15H,9H2,1-4H3,(H,26,27,28)/t15-/m1/s1 |
| InChIKey | KLQFMGWCMCDMEA-OAHLLOKOSA-N |
| XLogP | 3.53 |
| TPSA | 100.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.99 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|