C17H16ClN5S — CID 19696132
7-(4-chlorophenyl)-4,5,13-trimethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-amine (PubChem CID 19696132) has the molecular formula C17H16ClN5S and a molecular weight of 357.87 g/mol. Its IUPAC name is 7-(4-chlorophenyl)-4,5,13-trimethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-amine.
| Compound Name | 7-(4-chlorophenyl)-4,5,13-trimethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-amine |
|---|---|
| PubChem CID | 19696132 |
| Molecular Formula | C17H16ClN5S |
| Molecular Weight | 357.87 g/mol |
| Exact Mass | 357.08 |
| IUPAC Name | 7-(4-chlorophenyl)-4,5,13-trimethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-amine |
| SMILES | Cc1sc2c(c1C)C(c1ccc(Cl)cc1)=NC(N)c1nnc(C)n1-2 |
| InChI | InChI=1S/C17H16ClN5S/c1-8-9(2)24-17-13(8)14(11-4-6-12(18)7-5-11)20-15(19)16-22-21-10(3)23(16)17/h4-7,15H,19H2,1-3H3 |
| InChIKey | ZDUQKLFPRUEWCZ-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 69.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.87 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |