C20H21ClN4S — CID 139520052
7-(4-chlorophenyl)-4,5,13-trimethyl-9-propan-2-yl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaene (PubChem CID 139520052) has the molecular formula C20H21ClN4S and a molecular weight of 384.94 g/mol. Its IUPAC name is 7-(4-chlorophenyl)-4,5,13-trimethyl-9-propan-2-yl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaene.
| Compound Name | 7-(4-chlorophenyl)-4,5,13-trimethyl-9-propan-2-yl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaene |
|---|---|
| PubChem CID | 139520052 |
| Molecular Formula | C20H21ClN4S |
| Molecular Weight | 384.94 g/mol |
| Exact Mass | 384.12 |
| IUPAC Name | 7-(4-chlorophenyl)-4,5,13-trimethyl-9-propan-2-yl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaene |
| SMILES | Cc1sc2c(c1C)C(c1ccc(Cl)cc1)=NC(C(C)C)c1nnc(C)n1-2 |
| InChI | InChI=1S/C20H21ClN4S/c1-10(2)17-19-24-23-13(5)25(19)20-16(11(3)12(4)26-20)18(22-17)14-6-8-15(21)9-7-14/h6-10,17H,1-5H3 |
| InChIKey | RZJVFLJUMHGHHU-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 43.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.94 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |