About CID 123955907
CID 123955907 (PubChem CID 123955907) has the molecular formula C25H29BrN4O3
and a molecular weight of 513.44 g/mol.
Molecular Properties
| Compound Name | CID 123955907 |
| PubChem CID | 123955907 |
| Molecular Formula | C25H29BrN4O3 |
| Molecular Weight | 513.44 g/mol |
| Exact Mass | 512.14 |
| IUPAC Name | — |
| SMILES | COC1CCC2(CC1)Cc1ccc(Br)cc1C21N=C(C)N(C)C1=O.NC(=O)c1ccccn1 |
| InChI | InChI=1S/C19H23BrN2O2.C6H6N2O/c1-12-21-19(17(23)22(12)2)16-10-14(20)5-4-13(16)11-18(19)8-6-15(24-3)7-9-18;7-6(9)5-3-1-2-4-8-5/h4-5,10,15H,6-9,11H2,1-3H3;1-4H,(H2,7,9) |
| InChIKey | WNVKIWAJNKYNLJ-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 97.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 513.44 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze CID 123955907 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 123955907?
The IUPAC name of CID 123955907 (CID 123955907) is not available.
What is the SMILES notation for CID 123955907?
The canonical SMILES for CID 123955907 is COC1CCC2(CC1)Cc1ccc(Br)cc1C21N=C(C)N(C)C1=O.NC(=O)c1ccccn1.
What is the InChIKey of CID 123955907?
The InChIKey is WNVKIWAJNKYNLJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H23BrN2O2.C6H6N2O/c1-12-21-19(17(23)22(12)2)16-10-14(20)5-4-13(16)11-18(19)8-6-15(24-3)7-9-18;7-6(9)5-3-1-2-4-8-5/h4-5,10,15H,6-9,11H2,1-3H3;1-4H,(H2,7,9).
What are the key properties of CID 123955907?
CID 123955907 has a molecular weight of 513.44 g/mol, XLogP of 3.85, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 123955907 is sourced from PubChem (CID 123955907), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).