C38H33ClF9NO5 — CID 123956960
ethyl 6-[4-[(2S)-2-(5-chloro-2-pyridinyl)-2-[3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]-4-[4-fluoro-3-(trifluoromethyl)phenyl]-4-oxobutyl]phenoxy]hexanoate (PubChem CID 123956960) has the molecular formula C38H33ClF9NO5 and a molecular weight of 790.12 g/mol. Its IUPAC name is ethyl 6-[4-[(2S)-2-(5-chloro-2-pyridinyl)-2-[3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]-4-[4-fluoro-3-(trifluoromethyl)phenyl]-4-oxobutyl]phenoxy]hexanoate.
| Compound Name | ethyl 6-[4-[(2S)-2-(5-chloro-2-pyridinyl)-2-[3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]-4-[4-fluoro-3-(trifluoromethyl)phenyl]-4-oxobutyl]phenoxy]hexanoate |
|---|---|
| PubChem CID | 123956960 |
| Molecular Formula | C38H33ClF9NO5 |
| Molecular Weight | 790.12 g/mol |
| Exact Mass | 789.19 |
| IUPAC Name | ethyl 6-[4-[(2S)-2-(5-chloro-2-pyridinyl)-2-[3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]-4-[4-fluoro-3-(trifluoromethyl)phenyl]-4-oxobutyl]phenoxy]hexanoate |
| SMILES | CCOC(=O)CCCCCOc1ccc(C[C@](CC(=O)c2ccc(F)c(C(F)(F)F)c2)(c2cc(F)cc(OC(F)(F)C(F)F)c2)c2ccc(Cl)cn2)cc1 |
| InChI | InChI=1S/C38H33ClF9NO5/c1-2-52-34(51)6-4-3-5-15-53-28-11-7-23(8-12-28)20-36(33-14-10-26(39)22-49-33,21-32(50)24-9-13-31(41)30(16-24)37(44,45)46)25-17-27(40)19-29(18-25)54-38(47,48)35(42)43/h7-14,16-19,22,35H,2-6,15,20-21H2,1H3/t36-/m0/s1 |
| InChIKey | BBOBBFLCQNAYFU-BHVANESWSA-N |
| XLogP | 10.57 |
| TPSA | 74.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 790.12 |
| LogP ≤ 5 | 10.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|