C21H30ClN3O4S — CID 123957536
N-(2-carbamoylprop-2-enyl)-5-chloro-3-[ethyl-(4-methylsulfonylcyclohexyl)amino]-2-methylbenzamide (PubChem CID 123957536) has the molecular formula C21H30ClN3O4S and a molecular weight of 456.01 g/mol. Its IUPAC name is N-(2-carbamoylprop-2-enyl)-5-chloro-3-[ethyl-(4-methylsulfonylcyclohexyl)amino]-2-methylbenzamide.
| Compound Name | N-(2-carbamoylprop-2-enyl)-5-chloro-3-[ethyl-(4-methylsulfonylcyclohexyl)amino]-2-methylbenzamide |
|---|---|
| PubChem CID | 123957536 |
| Molecular Formula | C21H30ClN3O4S |
| Molecular Weight | 456.01 g/mol |
| Exact Mass | 455.16 |
| IUPAC Name | N-(2-carbamoylprop-2-enyl)-5-chloro-3-[ethyl-(4-methylsulfonylcyclohexyl)amino]-2-methylbenzamide |
| SMILES | C=C(CNC(=O)c1cc(Cl)cc(N(CC)C2CCC(S(C)(=O)=O)CC2)c1C)C(N)=O |
| InChI | InChI=1S/C21H30ClN3O4S/c1-5-25(16-6-8-17(9-7-16)30(4,28)29)19-11-15(22)10-18(14(19)3)21(27)24-12-13(2)20(23)26/h10-11,16-17H,2,5-9,12H2,1,3-4H3,(H2,23,26)(H,24,27) |
| InChIKey | FVVNWVDIXFJFTK-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 109.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.01 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|