C17H23N5O — CID 123957603
2-(3-methylmorpholin-4-yl)-4-N-(1-phenylethyl)pyrimidine-4,5-diamine (PubChem CID 123957603) has the molecular formula C17H23N5O and a molecular weight of 313.40 g/mol. Its IUPAC name is 2-(3-methylmorpholin-4-yl)-4-N-(1-phenylethyl)pyrimidine-4,5-diamine.
| Compound Name | 2-(3-methylmorpholin-4-yl)-4-N-(1-phenylethyl)pyrimidine-4,5-diamine |
|---|---|
| PubChem CID | 123957603 |
| Molecular Formula | C17H23N5O |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.19 |
| IUPAC Name | 2-(3-methylmorpholin-4-yl)-4-N-(1-phenylethyl)pyrimidine-4,5-diamine |
| SMILES | CC(Nc1nc(N2CCOCC2C)ncc1N)c1ccccc1 |
| InChI | InChI=1S/C17H23N5O/c1-12-11-23-9-8-22(12)17-19-10-15(18)16(21-17)20-13(2)14-6-4-3-5-7-14/h3-7,10,12-13H,8-9,11,18H2,1-2H3,(H,19,20,21) |
| InChIKey | VVLLTQWCVGEHPY-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 76.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |