C14H17N3O3S — CID 123958548
N,2-dimethoxy-2-[4-(5-methyl-1,3,4-thiadiazol-2-yl)phenyl]propanamide (PubChem CID 123958548) has the molecular formula C14H17N3O3S and a molecular weight of 307.38 g/mol. Its IUPAC name is N,2-dimethoxy-2-[4-(5-methyl-1,3,4-thiadiazol-2-yl)phenyl]propanamide.
| Compound Name | N,2-dimethoxy-2-[4-(5-methyl-1,3,4-thiadiazol-2-yl)phenyl]propanamide |
|---|---|
| PubChem CID | 123958548 |
| Molecular Formula | C14H17N3O3S |
| Molecular Weight | 307.38 g/mol |
| Exact Mass | 307.10 |
| IUPAC Name | N,2-dimethoxy-2-[4-(5-methyl-1,3,4-thiadiazol-2-yl)phenyl]propanamide |
| SMILES | CONC(=O)C(C)(OC)c1ccc(-c2nnc(C)s2)cc1 |
| InChI | InChI=1S/C14H17N3O3S/c1-9-15-16-12(21-9)10-5-7-11(8-6-10)14(2,19-3)13(18)17-20-4/h5-8H,1-4H3,(H,17,18) |
| InChIKey | OQBWIASNAGZSLK-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.38 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|