C22H32O3 — CID 123959831
3-ethenyl-3a-methyl-6-[2-(2-methyl-1,3-dioxolan-2-yl)ethyl]-2,3,4,5,8,9,9a,9b-octahydro-1H-cyclopenta[a]naphthalen-7-one (PubChem CID 123959831) has the molecular formula C22H32O3 and a molecular weight of 344.50 g/mol. Its IUPAC name is 3-ethenyl-3a-methyl-6-[2-(2-methyl-1,3-dioxolan-2-yl)ethyl]-2,3,4,5,8,9,9a,9b-octahydro-1H-cyclopenta[a]naphthalen-7-one.
| Compound Name | 3-ethenyl-3a-methyl-6-[2-(2-methyl-1,3-dioxolan-2-yl)ethyl]-2,3,4,5,8,9,9a,9b-octahydro-1H-cyclopenta[a]naphthalen-7-one |
|---|---|
| PubChem CID | 123959831 |
| Molecular Formula | C22H32O3 |
| Molecular Weight | 344.50 g/mol |
| Exact Mass | 344.24 |
| IUPAC Name | 3-ethenyl-3a-methyl-6-[2-(2-methyl-1,3-dioxolan-2-yl)ethyl]-2,3,4,5,8,9,9a,9b-octahydro-1H-cyclopenta[a]naphthalen-7-one |
| SMILES | C=CC1CCC2C3CCC(=O)C(CCC4(C)OCCO4)=C3CCC12C |
| InChI | InChI=1S/C22H32O3/c1-4-15-5-7-19-17-6-8-20(23)18(16(17)9-11-21(15,19)2)10-12-22(3)24-13-14-25-22/h4,15,17,19H,1,5-14H2,2-3H3 |
| InChIKey | NZUZMPLUVSCMQO-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.50 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|