C18H20F4N4OS — CID 123959861
N-[3-[2-[(1-amino-2-fluoropropylidene)amino]-3,3-difluorobutan-2-yl]-4-fluorophenyl]-4-methyl-1,3-thiazole-2-carboxamide (PubChem CID 123959861) has the molecular formula C18H20F4N4OS and a molecular weight of 416.44 g/mol. Its IUPAC name is N-[3-[2-[(1-amino-2-fluoropropylidene)amino]-3,3-difluorobutan-2-yl]-4-fluorophenyl]-4-methyl-1,3-thiazole-2-carboxamide.
| Compound Name | N-[3-[2-[(1-amino-2-fluoropropylidene)amino]-3,3-difluorobutan-2-yl]-4-fluorophenyl]-4-methyl-1,3-thiazole-2-carboxamide |
|---|---|
| PubChem CID | 123959861 |
| Molecular Formula | C18H20F4N4OS |
| Molecular Weight | 416.44 g/mol |
| Exact Mass | 416.13 |
| IUPAC Name | N-[3-[2-[(1-amino-2-fluoropropylidene)amino]-3,3-difluorobutan-2-yl]-4-fluorophenyl]-4-methyl-1,3-thiazole-2-carboxamide |
| SMILES | Cc1csc(C(=O)Nc2ccc(F)c(C(C)(/N=C(\N)C(C)F)C(C)(F)F)c2)n1 |
| InChI | InChI=1S/C18H20F4N4OS/c1-9-8-28-16(24-9)15(27)25-11-5-6-13(20)12(7-11)17(3,18(4,21)22)26-14(23)10(2)19/h5-8,10H,1-4H3,(H2,23,26)(H,25,27) |
| InChIKey | VAMAARIPAIALAT-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 80.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.44 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|