C17H20N6 — CID 123959882
1-[4-[1-(2-methylhepta-1,3,5-trien-4-yl)pyrazol-4-yl]-5-(methylideneamino)pyrazol-1-yl]ethanimine (PubChem CID 123959882) has the molecular formula C17H20N6 and a molecular weight of 308.39 g/mol. Its IUPAC name is 1-[4-[1-(2-methylhepta-1,3,5-trien-4-yl)pyrazol-4-yl]-5-(methylideneamino)pyrazol-1-yl]ethanimine.
| Compound Name | 1-[4-[1-(2-methylhepta-1,3,5-trien-4-yl)pyrazol-4-yl]-5-(methylideneamino)pyrazol-1-yl]ethanimine |
|---|---|
| PubChem CID | 123959882 |
| Molecular Formula | C17H20N6 |
| Molecular Weight | 308.39 g/mol |
| Exact Mass | 308.17 |
| IUPAC Name | 1-[4-[1-(2-methylhepta-1,3,5-trien-4-yl)pyrazol-4-yl]-5-(methylideneamino)pyrazol-1-yl]ethanimine |
| SMILES | [H]/N=C(\C)n1ncc(-c2cnn(C(C=CC)=CC(=C)C)c2)c1N=C |
| InChI | InChI=1S/C17H20N6/c1-6-7-15(8-12(2)3)22-11-14(9-20-22)16-10-21-23(13(4)18)17(16)19-5/h6-11,18H,2,5H2,1,3-4H3/b7-6?,15-8?,18-13+ |
| InChIKey | FFWSJVQLNZXASV-WEDQEUHYSA-N |
| XLogP | 3.92 |
| TPSA | 71.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.39 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|