C17H23N5 — CID 123278088
1-[2-ethenyl-4-(1-ethylpyrazol-4-yl)hexa-2,4-dienyl]-4-methylpyrazol-5-amine (PubChem CID 123278088) has the molecular formula C17H23N5 and a molecular weight of 297.41 g/mol. Its IUPAC name is 1-[2-ethenyl-4-(1-ethylpyrazol-4-yl)hexa-2,4-dienyl]-4-methylpyrazol-5-amine.
| Compound Name | 1-[2-ethenyl-4-(1-ethylpyrazol-4-yl)hexa-2,4-dienyl]-4-methylpyrazol-5-amine |
|---|---|
| PubChem CID | 123278088 |
| Molecular Formula | C17H23N5 |
| Molecular Weight | 297.41 g/mol |
| Exact Mass | 297.20 |
| IUPAC Name | 1-[2-ethenyl-4-(1-ethylpyrazol-4-yl)hexa-2,4-dienyl]-4-methylpyrazol-5-amine |
| SMILES | C=CC(=CC(=CC)c1cnn(CC)c1)Cn1ncc(C)c1N |
| InChI | InChI=1S/C17H23N5/c1-5-14(11-22-17(18)13(4)9-20-22)8-15(6-2)16-10-19-21(7-3)12-16/h5-6,8-10,12H,1,7,11,18H2,2-4H3 |
| InChIKey | BSACRQUQYAFRIX-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 61.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.41 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|