C16H27N3 — CID 144717413
ethane;N-ethyl-1-methyl-4-[(2Z,4E,6Z)-octa-2,4,6-trien-4-yl]pyrazol-5-amine (PubChem CID 144717413) has the molecular formula C16H27N3 and a molecular weight of 261.41 g/mol. Its IUPAC name is ethane;N-ethyl-1-methyl-4-[(2Z,4E,6Z)-octa-2,4,6-trien-4-yl]pyrazol-5-amine.
| Compound Name | ethane;N-ethyl-1-methyl-4-[(2Z,4E,6Z)-octa-2,4,6-trien-4-yl]pyrazol-5-amine |
|---|---|
| PubChem CID | 144717413 |
| Molecular Formula | C16H27N3 |
| Molecular Weight | 261.41 g/mol |
| Exact Mass | 261.22 |
| IUPAC Name | ethane;N-ethyl-1-methyl-4-[(2Z,4E,6Z)-octa-2,4,6-trien-4-yl]pyrazol-5-amine |
| SMILES | C/C=C\C=C(/C=C\C)c1cnn(C)c1NCC.CC |
| InChI | InChI=1S/C14H21N3.C2H6/c1-5-8-10-12(9-6-2)13-11-16-17(4)14(13)15-7-3;1-2/h5-6,8-11,15H,7H2,1-4H3;1-2H3/b8-5-,9-6-,12-10+; |
| InChIKey | KKZOMHUOZPRIGC-HYVNOKMVSA-N |
| XLogP | 4.41 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.41 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|