C17H21N5 — CID 123937238
4-[(Z)-5-cyclohepta-1,3,6-trien-1-yl-1-iminopent-2-en-2-yl]-1-ethanimidoylpyrazol-5-amine (PubChem CID 123937238) has the molecular formula C17H21N5 and a molecular weight of 295.39 g/mol. Its IUPAC name is 4-[(Z)-5-cyclohepta-1,3,6-trien-1-yl-1-iminopent-2-en-2-yl]-1-ethanimidoylpyrazol-5-amine.
| Compound Name | 4-[(Z)-5-cyclohepta-1,3,6-trien-1-yl-1-iminopent-2-en-2-yl]-1-ethanimidoylpyrazol-5-amine |
|---|---|
| PubChem CID | 123937238 |
| Molecular Formula | C17H21N5 |
| Molecular Weight | 295.39 g/mol |
| Exact Mass | 295.18 |
| IUPAC Name | 4-[(Z)-5-cyclohepta-1,3,6-trien-1-yl-1-iminopent-2-en-2-yl]-1-ethanimidoylpyrazol-5-amine |
| SMILES | [H]/N=C/C(=C\CCC1=CC=CCC=C1)c1cnn(/C(C)=N/[H])c1N |
| InChI | InChI=1S/C17H21N5/c1-13(19)22-17(20)16(12-21-22)15(11-18)10-6-9-14-7-4-2-3-5-8-14/h2,4-5,7-8,10-12,18-19H,3,6,9,20H2,1H3/b15-10+,18-11+,19-13+ |
| InChIKey | UZHZWQUSIZYQOM-KZURSRKVSA-N |
| XLogP | 3.57 |
| TPSA | 91.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.39 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|