C11H15N3 — CID 145048729
4-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-1-methylpyrazol-5-amine (PubChem CID 145048729) has the molecular formula C11H15N3 and a molecular weight of 189.26 g/mol. Its IUPAC name is 4-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-1-methylpyrazol-5-amine.
| Compound Name | 4-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-1-methylpyrazol-5-amine |
|---|---|
| PubChem CID | 145048729 |
| Molecular Formula | C11H15N3 |
| Molecular Weight | 189.26 g/mol |
| Exact Mass | 189.13 |
| IUPAC Name | 4-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-1-methylpyrazol-5-amine |
| SMILES | C=C/C=C\C(=C/C)c1cnn(C)c1N |
| InChI | InChI=1S/C11H15N3/c1-4-6-7-9(5-2)10-8-13-14(3)11(10)12/h4-8H,1,12H2,2-3H3/b7-6-,9-5+ |
| InChIKey | BRNDMLLJZXNYJQ-QRLJIZSYSA-N |
| XLogP | 2.15 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.26 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|