C8H10N4 — CID 58077624
4-(1-methylpyrazol-4-yl)-2H-pyrrol-5-amine (PubChem CID 58077624) has the molecular formula C8H10N4 and a molecular weight of 162.20 g/mol. Its IUPAC name is 4-(1-methylpyrazol-4-yl)-2H-pyrrol-5-amine.
| Compound Name | 4-(1-methylpyrazol-4-yl)-2H-pyrrol-5-amine |
|---|---|
| PubChem CID | 58077624 |
| Molecular Formula | C8H10N4 |
| Molecular Weight | 162.20 g/mol |
| Exact Mass | 162.09 |
| IUPAC Name | 4-(1-methylpyrazol-4-yl)-2H-pyrrol-5-amine |
| SMILES | Cn1cc(C2=CCN=C2N)cn1 |
| InChI | InChI=1S/C8H10N4/c1-12-5-6(4-11-12)7-2-3-10-8(7)9/h2,4-5H,3H2,1H3,(H2,9,10) |
| InChIKey | JPPDTAVYZITNRI-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 56.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.20 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |