C11H13F2N3 — CID 145105885
(2E,4E)-4,6-difluoro-5-(1-methylpyrazol-4-yl)hepta-2,4,6-trien-3-amine (PubChem CID 145105885) has the molecular formula C11H13F2N3 and a molecular weight of 225.24 g/mol. Its IUPAC name is (2E,4E)-4,6-difluoro-5-(1-methylpyrazol-4-yl)hepta-2,4,6-trien-3-amine.
| Compound Name | (2E,4E)-4,6-difluoro-5-(1-methylpyrazol-4-yl)hepta-2,4,6-trien-3-amine |
|---|---|
| PubChem CID | 145105885 |
| Molecular Formula | C11H13F2N3 |
| Molecular Weight | 225.24 g/mol |
| Exact Mass | 225.11 |
| IUPAC Name | (2E,4E)-4,6-difluoro-5-(1-methylpyrazol-4-yl)hepta-2,4,6-trien-3-amine |
| SMILES | C=C(F)/C(=C(F)\C(N)=C/C)c1cnn(C)c1 |
| InChI | InChI=1S/C11H13F2N3/c1-4-9(14)11(13)10(7(2)12)8-5-15-16(3)6-8/h4-6H,2,14H2,1,3H3/b9-4-,11-10- |
| InChIKey | PTEPWWVWMODWPY-ISIMONSRSA-N |
| XLogP | 2.45 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.24 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|