C11H14F2N2O — CID 123878340
4-[5-(difluoromethoxy)hexa-2,4-dien-3-yl]-1-methylpyrazole (PubChem CID 123878340) has the molecular formula C11H14F2N2O and a molecular weight of 228.24 g/mol. Its IUPAC name is 4-[5-(difluoromethoxy)hexa-2,4-dien-3-yl]-1-methylpyrazole.
| Compound Name | 4-[5-(difluoromethoxy)hexa-2,4-dien-3-yl]-1-methylpyrazole |
|---|---|
| PubChem CID | 123878340 |
| Molecular Formula | C11H14F2N2O |
| Molecular Weight | 228.24 g/mol |
| Exact Mass | 228.11 |
| IUPAC Name | 4-[5-(difluoromethoxy)hexa-2,4-dien-3-yl]-1-methylpyrazole |
| SMILES | CC=C(C=C(C)OC(F)F)c1cnn(C)c1 |
| InChI | InChI=1S/C11H14F2N2O/c1-4-9(5-8(2)16-11(12)13)10-6-14-15(3)7-10/h4-7,11H,1-3H3 |
| InChIKey | ZGMIAHROFHLALF-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.24 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|