C16H27F3N2O — CID 142510623
ethane;1,1,1-trifluoro-2-methyl-3-[4-[(2E)-penta-2,4-dien-2-yl]pyrazol-1-yl]propan-2-ol (PubChem CID 142510623) has the molecular formula C16H27F3N2O and a molecular weight of 320.40 g/mol. Its IUPAC name is ethane;1,1,1-trifluoro-2-methyl-3-[4-[(2E)-penta-2,4-dien-2-yl]pyrazol-1-yl]propan-2-ol.
| Compound Name | ethane;1,1,1-trifluoro-2-methyl-3-[4-[(2E)-penta-2,4-dien-2-yl]pyrazol-1-yl]propan-2-ol |
|---|---|
| PubChem CID | 142510623 |
| Molecular Formula | C16H27F3N2O |
| Molecular Weight | 320.40 g/mol |
| Exact Mass | 320.21 |
| IUPAC Name | ethane;1,1,1-trifluoro-2-methyl-3-[4-[(2E)-penta-2,4-dien-2-yl]pyrazol-1-yl]propan-2-ol |
| SMILES | C=C/C=C(\C)c1cnn(CC(C)(O)C(F)(F)F)c1.CC.CC |
| InChI | InChI=1S/C12H15F3N2O.2C2H6/c1-4-5-9(2)10-6-16-17(7-10)8-11(3,18)12(13,14)15;2*1-2/h4-7,18H,1,8H2,2-3H3;2*1-2H3/b9-5+;; |
| InChIKey | RDALDVJMSRNVQL-KJDUPKRESA-N |
| XLogP | 4.84 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.40 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|