C10H11F3N2 — CID 153359424
4-(4-methylpenta-1,3-dien-3-yl)-1-(trifluoromethyl)pyrazole (PubChem CID 153359424) has the molecular formula C10H11F3N2 and a molecular weight of 216.21 g/mol. Its IUPAC name is 4-(4-methylpenta-1,3-dien-3-yl)-1-(trifluoromethyl)pyrazole.
| Compound Name | 4-(4-methylpenta-1,3-dien-3-yl)-1-(trifluoromethyl)pyrazole |
|---|---|
| PubChem CID | 153359424 |
| Molecular Formula | C10H11F3N2 |
| Molecular Weight | 216.21 g/mol |
| Exact Mass | 216.09 |
| IUPAC Name | 4-(4-methylpenta-1,3-dien-3-yl)-1-(trifluoromethyl)pyrazole |
| SMILES | C=CC(=C(C)C)c1cnn(C(F)(F)F)c1 |
| InChI | InChI=1S/C10H11F3N2/c1-4-9(7(2)3)8-5-14-15(6-8)10(11,12)13/h4-6H,1H2,2-3H3 |
| InChIKey | CIHNWDGTHFBYKD-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.21 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|